ChemNet > CAS > 20481-33-8 diethyl 2-{[(1,3-dimethyl-1H-pyrazol-5-yl)amino]methylidene}malonate
20481-33-8 diethyl 2-{[(1,3-dimethyl-1H-pyrazol-5-yl)amino]methylidene}malonate
| Название продукта |
diethyl 2-{[(1,3-dimethyl-1H-pyrazol-5-yl)amino]methylidene}malonate |
| Английское название |
diethyl 2-{[(1,3-dimethyl-1H-pyrazol-5-yl)amino]methylidene}malonate; Diethyl 2-[[(1,3-dimethyl-1H-pyrazol-5-yl)amino]methylidene]malonate; diethyl {[(1,3-dimethyl-1H-pyrazol-5-yl)amino]methylidene}propanedioate |
| Молекулярная формула |
C13H19N3O4 |
| Молекулярный вес |
281.3077 |
| InChI |
InChI=1/C13H19N3O4/c1-5-19-12(17)10(13(18)20-6-2)8-14-11-7-9(3)15-16(11)4/h7-8,14H,5-6H2,1-4H3 |
| Регистрационный номер CAS |
20481-33-8 |
| Молекулярная структура |
|
| Плотность |
1.18g/cm3 |
| Температура плавления |
85℃ |
| Точка кипения |
366.7°C at 760 mmHg |
| Показатель преломления |
1.532 |
| Температура вспышки |
175.6°C |
| Давление пара |
1.43E-05mmHg at 25°C |
| Символы опасности |
Xi:Irritant;
|
| Риск коды |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|